C20H19FN4O — CID 24862231
(2R,6R)-4-benzyl-10-(2-fluorophenyl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 24862231) has the molecular formula C20H19FN4O and a molecular weight of 350.40 g/mol. Its IUPAC name is (2R,6R)-4-benzyl-10-(2-fluorophenyl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2R,6R)-4-benzyl-10-(2-fluorophenyl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 24862231 |
| Molecular Formula | C20H19FN4O |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (2R,6R)-4-benzyl-10-(2-fluorophenyl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | Fc1ccccc1-c1nnn2c1CO[C@@H]1CN(Cc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C20H19FN4O/c21-16-9-5-4-8-15(16)20-18-13-26-19-12-24(10-14-6-2-1-3-7-14)11-17(19)25(18)23-22-20/h1-9,17,19H,10-13H2/t17-,19-/m1/s1 |
| InChIKey | BZGBCMQYDJZLBR-IEBWSBKVSA-N |
| XLogP | 3.04 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |