C17H26O2 — CID 24862281
[(3aS,3bS,5S,6aR,7aS)-3,3,7a-trimethyl-4-methylidene-1,2,3a,3b,5,6,6a,7-octahydrocyclopenta[a]pentalen-5-yl] acetate (PubChem CID 24862281) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is [(3aS,3bS,5S,6aR,7aS)-3,3,7a-trimethyl-4-methylidene-1,2,3a,3b,5,6,6a,7-octahydrocyclopenta[a]pentalen-5-yl] acetate.
| Compound Name | [(3aS,3bS,5S,6aR,7aS)-3,3,7a-trimethyl-4-methylidene-1,2,3a,3b,5,6,6a,7-octahydrocyclopenta[a]pentalen-5-yl] acetate |
|---|---|
| PubChem CID | 24862281 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | [(3aS,3bS,5S,6aR,7aS)-3,3,7a-trimethyl-4-methylidene-1,2,3a,3b,5,6,6a,7-octahydrocyclopenta[a]pentalen-5-yl] acetate |
| SMILES | C=C1[C@H]2[C@@H](C[C@@H]1OC(C)=O)C[C@]1(C)CCC(C)(C)[C@H]21 |
| InChI | InChI=1S/C17H26O2/c1-10-13(19-11(2)18)8-12-9-17(5)7-6-16(3,4)15(17)14(10)12/h12-15H,1,6-9H2,2-5H3/t12-,13-,14-,15-,17-/m0/s1 |
| InChIKey | IHWUYFCEAFFNMA-BWJWTDLKSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|