C24H34O11 — CID 24862328
[(1S,2S,3S,4S,7S,8Z,11R,12S,13S,16R,17S)-2-acetyloxy-3,4,12,16,17-pentahydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-11-yl] acetate (PubChem CID 24862328) has the molecular formula C24H34O11 and a molecular weight of 498.53 g/mol. Its IUPAC name is [(1S,2S,3S,4S,7S,8Z,11R,12S,13S,16R,17S)-2-acetyloxy-3,4,12,16,17-pentahydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-11-yl] acetate.
| Compound Name | [(1S,2S,3S,4S,7S,8Z,11R,12S,13S,16R,17S)-2-acetyloxy-3,4,12,16,17-pentahydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-11-yl] acetate |
|---|---|
| PubChem CID | 24862328 |
| Molecular Formula | C24H34O11 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | [(1S,2S,3S,4S,7S,8Z,11R,12S,13S,16R,17S)-2-acetyloxy-3,4,12,16,17-pentahydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-11-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C/C(C)=C\[C@@H]2OC(=O)[C@@](C)(O)[C@@]2(O)[C@@H](OC(C)=O)[C@H]2[C@](C)(O)[C@H](O)C=C[C@]2(C)[C@@H]1O |
| InChI | InChI=1S/C24H34O11/c1-11-9-14(33-12(2)25)18(28)21(4)8-7-15(27)22(5,30)17(21)19(34-13(3)26)24(32)16(10-11)35-20(29)23(24,6)31/h7-8,10,14-19,27-28,30-32H,9H2,1-6H3/b11-10-/t14-,15-,16+,17-,18-,19+,21+,22-,23-,24+/m1/s1 |
| InChIKey | YTZFJBSCTCHJJN-IUCXHJHKSA-N |
| XLogP | -0.73 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|