C24H34N4O2Se2 — CID 24862332
(2S)-2-amino-N-[2-[[2-[[(2S)-2-amino-4-methylpentanoyl]amino]phenyl]diselanyl]phenyl]-4-methylpentanamide (PubChem CID 24862332) has the molecular formula C24H34N4O2Se2 and a molecular weight of 568.48 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[[2-[[(2S)-2-amino-4-methylpentanoyl]amino]phenyl]diselanyl]phenyl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[2-[[2-[[(2S)-2-amino-4-methylpentanoyl]amino]phenyl]diselanyl]phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 24862332 |
| Molecular Formula | C24H34N4O2Se2 |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | (2S)-2-amino-N-[2-[[2-[[(2S)-2-amino-4-methylpentanoyl]amino]phenyl]diselanyl]phenyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1ccccc1[Se][Se]c1ccccc1NC(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C24H34N4O2Se2/c1-15(2)13-17(25)23(29)27-19-9-5-7-11-21(19)31-32-22-12-8-6-10-20(22)28-24(30)18(26)14-16(3)4/h5-12,15-18H,13-14,25-26H2,1-4H3,(H,27,29)(H,28,30)/t17-,18-/m0/s1 |
| InChIKey | FZUXFCUSGKHYJP-ROUUACIJSA-N |
| XLogP | 1.58 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|