About [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate
[(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate (PubChem CID 24862361) has the molecular formula C18H36O3Si
and a molecular weight of 328.57 g/mol. Its IUPAC name is [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate.
Molecular Properties
| Compound Name | [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate |
| PubChem CID | 24862361 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate |
| SMILES | CC(=O)OC(CC=C(C)C)[C@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-14(2)10-11-17(21-16(4)19)15(3)12-13-20-22(8,9)18(5,6)7/h10,15,17H,11-13H2,1-9H3/t15-,17?/m1/s1 |
| InChIKey | PIYRZXQRZMRQAM-LDCVWXEPSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate?
The IUPAC name of [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate (CID 24862361) is [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate.
What is the SMILES notation for [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate?
The canonical SMILES for [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate is CC(=O)OC(CC=C(C)C)[C@H](C)CCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate?
The InChIKey is PIYRZXQRZMRQAM-LDCVWXEPSA-N. The full InChI is InChI=1S/C18H36O3Si/c1-14(2)10-11-17(21-16(4)19)15(3)12-13-20-22(8,9)18(5,6)7/h10,15,17H,11-13H2,1-9H3/t15-,17?/m1/s1.
What are the key properties of [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate?
[(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate has a molecular weight of 328.57 g/mol, XLogP of 5.32, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-en-4-yl] acetate is sourced from PubChem (CID 24862361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).