C21H36O9 — CID 24862396
methyl 2-[(2R,4S,6R)-6-[(2S)-2-hydroxypent-4-enyl]-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetate (PubChem CID 24862396) has the molecular formula C21H36O9 and a molecular weight of 432.51 g/mol. Its IUPAC name is methyl 2-[(2R,4S,6R)-6-[(2S)-2-hydroxypent-4-enyl]-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4S,6R)-6-[(2S)-2-hydroxypent-4-enyl]-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 24862396 |
| Molecular Formula | C21H36O9 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | methyl 2-[(2R,4S,6R)-6-[(2S)-2-hydroxypent-4-enyl]-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetate |
| SMILES | C=CC[C@H](O)C[C@@H]1C[C@H](O[C@@H]2OC[C@@H](OC)[C@H](OC)[C@H]2OC)C[C@H](CC(=O)OC)O1 |
| InChI | InChI=1S/C21H36O9/c1-6-7-13(22)8-14-9-15(10-16(29-14)11-18(23)25-3)30-21-20(27-5)19(26-4)17(24-2)12-28-21/h6,13-17,19-22H,1,7-12H2,2-5H3/t13-,14+,15-,16+,17+,19-,20+,21-/m0/s1 |
| InChIKey | PVVYBHXDHRSRPN-WNYILOLCSA-N |
| XLogP | 1.21 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|