C16H24O5 — CID 24862534
(2R,3aR,9aS)-3a-hydroxy-2-(2-hydroxypropan-2-yl)-6,6-dimethyl-2,3,4,7,9,9a-hexahydrofuro[2,3-g]chromen-8-one (PubChem CID 24862534) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (2R,3aR,9aS)-3a-hydroxy-2-(2-hydroxypropan-2-yl)-6,6-dimethyl-2,3,4,7,9,9a-hexahydrofuro[2,3-g]chromen-8-one.
| Compound Name | (2R,3aR,9aS)-3a-hydroxy-2-(2-hydroxypropan-2-yl)-6,6-dimethyl-2,3,4,7,9,9a-hexahydrofuro[2,3-g]chromen-8-one |
|---|---|
| PubChem CID | 24862534 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (2R,3aR,9aS)-3a-hydroxy-2-(2-hydroxypropan-2-yl)-6,6-dimethyl-2,3,4,7,9,9a-hexahydrofuro[2,3-g]chromen-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C[C@]3(O)C[C@H](C(C)(C)O)O[C@H]3C2)O1 |
| InChI | InChI=1S/C16H24O5/c1-14(2)6-10(17)9-5-12-16(19,7-11(9)21-14)8-13(20-12)15(3,4)18/h12-13,18-19H,5-8H2,1-4H3/t12-,13+,16-/m0/s1 |
| InChIKey | SZJDSGYDVCCKMU-ZENOOKHLSA-N |
| XLogP | 1.46 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |