C21H30O5 — CID 24862634
(3R,6Z,10Z)-14-(2,5-dioxofuran-3-yl)-3,7,11-trimethyltetradeca-6,10-dienoic acid (PubChem CID 24862634) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (3R,6Z,10Z)-14-(2,5-dioxofuran-3-yl)-3,7,11-trimethyltetradeca-6,10-dienoic acid.
| Compound Name | (3R,6Z,10Z)-14-(2,5-dioxofuran-3-yl)-3,7,11-trimethyltetradeca-6,10-dienoic acid |
|---|---|
| PubChem CID | 24862634 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (3R,6Z,10Z)-14-(2,5-dioxofuran-3-yl)-3,7,11-trimethyltetradeca-6,10-dienoic acid |
| SMILES | C/C(=C/CC[C@@H](C)CC(=O)O)CC/C=C(/C)CCCC1=CC(=O)OC1=O |
| InChI | InChI=1S/C21H30O5/c1-15(9-5-11-17(3)13-19(22)23)7-4-8-16(2)10-6-12-18-14-20(24)26-21(18)25/h8-9,14,17H,4-7,10-13H2,1-3H3,(H,22,23)/b15-9-,16-8-/t17-/m1/s1 |
| InChIKey | ULSWZKPKBXRFOP-XBCBCFQOSA-N |
| XLogP | 4.73 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|