About CID 24862652
CID 24862652 (PubChem CID 24862652) has the molecular formula C11H8N2
and a molecular weight of 168.20 g/mol.
Molecular Properties
| Compound Name | CID 24862652 |
| PubChem CID | 24862652 |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | — |
| SMILES | [C]1N2C=CC=CC2=C2C=CC=CN12 |
| InChI | InChI=1S/C11H8N2/c1-3-7-12-9-13-8-4-2-6-11(13)10(12)5-1/h1-8H |
| InChIKey | ITEUMZSMHUSLRX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 24862652 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24862652?
The IUPAC name of CID 24862652 (CID 24862652) is not available.
What is the SMILES notation for CID 24862652?
The canonical SMILES for CID 24862652 is [C]1N2C=CC=CC2=C2C=CC=CN12.
What is the InChIKey of CID 24862652?
The InChIKey is ITEUMZSMHUSLRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2/c1-3-7-12-9-13-8-4-2-6-11(13)10(12)5-1/h1-8H.
What are the key properties of CID 24862652?
CID 24862652 has a molecular weight of 168.20 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24862652 is sourced from PubChem (CID 24862652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).