C26H32O2 — CID 24863253
(6aR,10aR)-6,6,9-trimethyl-3-[2-(4-methylphenyl)propan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 24863253) has the molecular formula C26H32O2 and a molecular weight of 376.54 g/mol. Its IUPAC name is (6aR,10aR)-6,6,9-trimethyl-3-[2-(4-methylphenyl)propan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-6,6,9-trimethyl-3-[2-(4-methylphenyl)propan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 24863253 |
| Molecular Formula | C26H32O2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (6aR,10aR)-6,6,9-trimethyl-3-[2-(4-methylphenyl)propan-2-yl]-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CC1=CC[C@@H]2[C@@H](C1)c1c(O)cc(C(C)(C)c3ccc(C)cc3)cc1OC2(C)C |
| InChI | InChI=1S/C26H32O2/c1-16-7-10-18(11-8-16)25(3,4)19-14-22(27)24-20-13-17(2)9-12-21(20)26(5,6)28-23(24)15-19/h7-11,14-15,20-21,27H,12-13H2,1-6H3/t20-,21-/m1/s1 |
| InChIKey | MOBRNYCBEKVFQX-NHCUHLMSSA-N |
| XLogP | 6.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|