C15H20ClN3O2S — CID 24863649
4-chloro-N-[1-(4,5-diethyl-1H-pyrazol-3-yl)ethyl]benzenesulfonamide (PubChem CID 24863649) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is 4-chloro-N-[1-(4,5-diethyl-1H-pyrazol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[1-(4,5-diethyl-1H-pyrazol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24863649 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 4-chloro-N-[1-(4,5-diethyl-1H-pyrazol-3-yl)ethyl]benzenesulfonamide |
| SMILES | CCc1[nH]nc(C(C)NS(=O)(=O)c2ccc(Cl)cc2)c1CC |
| InChI | InChI=1S/C15H20ClN3O2S/c1-4-13-14(5-2)17-18-15(13)10(3)19-22(20,21)12-8-6-11(16)7-9-12/h6-10,19H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | UXXJDSVDRHSHCY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |