About 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one
2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one (PubChem CID 24863747) has the molecular formula C22H22Cl2FNO
and a molecular weight of 406.33 g/mol. Its IUPAC name is 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one |
| PubChem CID | 24863747 |
| Molecular Formula | C22H22Cl2FNO |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one |
| SMILES | O=C1N(Cc2c(Cl)cc(-c3ccc(F)cc3)cc2Cl)CCC12CCCCC2 |
| InChI | InChI=1S/C22H22Cl2FNO/c23-19-12-16(15-4-6-17(25)7-5-15)13-20(24)18(19)14-26-11-10-22(21(26)27)8-2-1-3-9-22/h4-7,12-13H,1-3,8-11,14H2 |
| InChIKey | SWDNXBOKVMFSPQ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one?
The IUPAC name of 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one (CID 24863747) is 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one.
What is the SMILES notation for 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one?
The canonical SMILES for 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one is O=C1N(Cc2c(Cl)cc(-c3ccc(F)cc3)cc2Cl)CCC12CCCCC2.
What is the InChIKey of 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one?
The InChIKey is SWDNXBOKVMFSPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22Cl2FNO/c23-19-12-16(15-4-6-17(25)7-5-15)13-20(24)18(19)14-26-11-10-22(21(26)27)8-2-1-3-9-22/h4-7,12-13H,1-3,8-11,14H2.
What are the key properties of 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one?
2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one has a molecular weight of 406.33 g/mol, XLogP of 6.48, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,6-dichloro-4-(4-fluorophenyl)phenyl]methyl]-2-azaspiro[4.5]decan-1-one is sourced from PubChem (CID 24863747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).