C30H29Cl2F3N4O2 — CID 24863841
1'-[[2,6-dichloro-4-[4-[4-(trifluoromethyl)piperidine-1-carbonyl]phenyl]phenyl]methyl]spiro[1,4,6,7-tetrahydroindazole-5,3'-pyrrolidine]-2'-one (PubChem CID 24863841) has the molecular formula C30H29Cl2F3N4O2 and a molecular weight of 605.49 g/mol. Its IUPAC name is 1'-[[2,6-dichloro-4-[4-[4-(trifluoromethyl)piperidine-1-carbonyl]phenyl]phenyl]methyl]spiro[1,4,6,7-tetrahydroindazole-5,3'-pyrrolidine]-2'-one.
| Compound Name | 1'-[[2,6-dichloro-4-[4-[4-(trifluoromethyl)piperidine-1-carbonyl]phenyl]phenyl]methyl]spiro[1,4,6,7-tetrahydroindazole-5,3'-pyrrolidine]-2'-one |
|---|---|
| PubChem CID | 24863841 |
| Molecular Formula | C30H29Cl2F3N4O2 |
| Molecular Weight | 605.49 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | 1'-[[2,6-dichloro-4-[4-[4-(trifluoromethyl)piperidine-1-carbonyl]phenyl]phenyl]methyl]spiro[1,4,6,7-tetrahydroindazole-5,3'-pyrrolidine]-2'-one |
| SMILES | O=C(c1ccc(-c2cc(Cl)c(CN3CCC4(CCc5[nH]ncc5C4)C3=O)c(Cl)c2)cc1)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C30H29Cl2F3N4O2/c31-24-13-20(18-1-3-19(4-2-18)27(40)38-10-6-22(7-11-38)30(33,34)35)14-25(32)23(24)17-39-12-9-29(28(39)41)8-5-26-21(15-29)16-36-37-26/h1-4,13-14,16,22H,5-12,15,17H2,(H,36,37) |
| InChIKey | QTCZCNPJWDKGRW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.49 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |