About (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol
(2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol (PubChem CID 24864009) has the molecular formula C18H30N2O3
and a molecular weight of 322.45 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol.
Molecular Properties
| Compound Name | (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol |
| PubChem CID | 24864009 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol |
| SMILES | CCC1(c2cccc(O)c2)CCCCN(C)C1.C[C@H](N)C(=O)O |
| InChI | InChI=1S/C15H23NO.C3H7NO2/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13;1-2(4)3(5)6/h6-8,11,17H,3-5,9-10,12H2,1-2H3;2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | JLMZKGMMSVIIPK-WNQIDUERSA-N |
| XLogP | 2.57 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol?
The IUPAC name of (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol (CID 24864009) is (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol.
What is the SMILES notation for (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol?
The canonical SMILES for (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol is CCC1(c2cccc(O)c2)CCCCN(C)C1.C[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol?
The InChIKey is JLMZKGMMSVIIPK-WNQIDUERSA-N. The full InChI is InChI=1S/C15H23NO.C3H7NO2/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13;1-2(4)3(5)6/h6-8,11,17H,3-5,9-10,12H2,1-2H3;2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1.
What are the key properties of (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol?
(2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol has a molecular weight of 322.45 g/mol, XLogP of 2.57, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopropanoic acid;3-(3-ethyl-1-methylazepan-3-yl)phenol is sourced from PubChem (CID 24864009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).