C14H19NO6 — CID 24864076
(5R,6R,7S,8S,9R)-9-(hydroxymethyl)-3-phenyl-1,10-dioxa-2-azaspiro[4.5]decane-6,7,8-triol (PubChem CID 24864076) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is (5R,6R,7S,8S,9R)-9-(hydroxymethyl)-3-phenyl-1,10-dioxa-2-azaspiro[4.5]decane-6,7,8-triol.
| Compound Name | (5R,6R,7S,8S,9R)-9-(hydroxymethyl)-3-phenyl-1,10-dioxa-2-azaspiro[4.5]decane-6,7,8-triol |
|---|---|
| PubChem CID | 24864076 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (5R,6R,7S,8S,9R)-9-(hydroxymethyl)-3-phenyl-1,10-dioxa-2-azaspiro[4.5]decane-6,7,8-triol |
| SMILES | OC[C@H]1O[C@@]2(CC(c3ccccc3)NO2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19NO6/c16-7-10-11(17)12(18)13(19)14(20-10)6-9(15-21-14)8-4-2-1-3-5-8/h1-5,9-13,15-19H,6-7H2/t9?,10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | QBUGZXNWSVFUBB-MXNNCRBYSA-N |
| XLogP | -1.18 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |