C10H10O — CID 24864594
(1S,2S,3S)-1,2-dideuterio-3-phenylcyclopropane-1-carbaldehyde (PubChem CID 24864594) has the molecular formula C10H10O and a molecular weight of 148.20 g/mol. Its IUPAC name is (1S,2S,3S)-1,2-dideuterio-3-phenylcyclopropane-1-carbaldehyde.
| Compound Name | (1S,2S,3S)-1,2-dideuterio-3-phenylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 24864594 |
| Molecular Formula | C10H10O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (1S,2S,3S)-1,2-dideuterio-3-phenylcyclopropane-1-carbaldehyde |
| SMILES | [2H][C@H]1[C@H](c2ccccc2)[C@@]1([2H])C=O |
| InChI | InChI=1S/C10H10O/c11-7-9-6-10(9)8-4-2-1-3-5-8/h1-5,7,9-10H,6H2/t9-,10-/m1/s1/i6D,9D/t6-,9-,10- |
| InChIKey | TYJRXMZXDBSURR-DISRSHGRSA-N |
| XLogP | 1.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|