C17H22N2O — CID 24864740
16-methyl-5-propan-2-yl-4-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene (PubChem CID 24864740) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 16-methyl-5-propan-2-yl-4-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene.
| Compound Name | 16-methyl-5-propan-2-yl-4-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene |
|---|---|
| PubChem CID | 24864740 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 16-methyl-5-propan-2-yl-4-oxa-6,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraene |
| SMILES | CC(C)C1OCC2c3c(c4ccccc4n3C)CCN21 |
| InChI | InChI=1S/C17H22N2O/c1-11(2)17-19-9-8-13-12-6-4-5-7-14(12)18(3)16(13)15(19)10-20-17/h4-7,11,15,17H,8-10H2,1-3H3 |
| InChIKey | LXIGYDJHRLWLHN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|