C20H21FN6O — CID 24864837
6-[4-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 24864837) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is 6-[4-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 6-[4-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24864837 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 6-[4-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCN(Cc3cn[nH]c3-c3ccc(F)cc3)CC2)nc1 |
| InChI | InChI=1S/C20H21FN6O/c21-17-4-1-14(2-5-17)19-16(12-24-25-19)13-26-7-9-27(10-8-26)18-6-3-15(11-23-18)20(22)28/h1-6,11-12H,7-10,13H2,(H2,22,28)(H,24,25) |
| InChIKey | JWZDZWQBACLRTN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |