About 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione
6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione (PubChem CID 24864956) has the molecular formula C19H20O5
and a molecular weight of 328.36 g/mol. Its IUPAC name is 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione.
Molecular Properties
| Compound Name | 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione |
| PubChem CID | 24864956 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione |
| SMILES | CC1(C)C=CC(=O)c2c1ccc1c2C(OC2CCCCO2)OC1=O |
| InChI | InChI=1S/C19H20O5/c1-19(2)9-8-13(20)16-12(19)7-6-11-15(16)18(24-17(11)21)23-14-5-3-4-10-22-14/h6-9,14,18H,3-5,10H2,1-2H3 |
| InChIKey | FTHPEKSTMRTYOH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione?
The IUPAC name of 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione (CID 24864956) is 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione.
What is the SMILES notation for 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione?
The canonical SMILES for 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione is CC1(C)C=CC(=O)c2c1ccc1c2C(OC2CCCCO2)OC1=O.
What is the InChIKey of 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione?
The InChIKey is FTHPEKSTMRTYOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O5/c1-19(2)9-8-13(20)16-12(19)7-6-11-15(16)18(24-17(11)21)23-14-5-3-4-10-22-14/h6-9,14,18H,3-5,10H2,1-2H3.
What are the key properties of 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione?
6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione has a molecular weight of 328.36 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1-(oxan-2-yloxy)-1H-benzo[e][2]benzofuran-3,9-dione is sourced from PubChem (CID 24864956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).