About 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione
1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione (PubChem CID 24864983) has the molecular formula C30H36N2O4
and a molecular weight of 488.63 g/mol. Its IUPAC name is 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione.
Molecular Properties
| Compound Name | 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione |
| PubChem CID | 24864983 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione |
| SMILES | CCCCCCOc1cccc2c1C(=O)c1c(OCCCCCC)cc(Cn3ccnc3)cc1C2=O |
| InChI | InChI=1S/C30H36N2O4/c1-3-5-7-9-16-35-25-13-11-12-23-27(25)30(34)28-24(29(23)33)18-22(20-32-15-14-31-21-32)19-26(28)36-17-10-8-6-4-2/h11-15,18-19,21H,3-10,16-17,20H2,1-2H3 |
| InChIKey | MYNWSRCWNLNUBH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione?
The IUPAC name of 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione (CID 24864983) is 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione.
What is the SMILES notation for 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione?
The canonical SMILES for 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione is CCCCCCOc1cccc2c1C(=O)c1c(OCCCCCC)cc(Cn3ccnc3)cc1C2=O.
What is the InChIKey of 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione?
The InChIKey is MYNWSRCWNLNUBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H36N2O4/c1-3-5-7-9-16-35-25-13-11-12-23-27(25)30(34)28-24(29(23)33)18-22(20-32-15-14-31-21-32)19-26(28)36-17-10-8-6-4-2/h11-15,18-19,21H,3-10,16-17,20H2,1-2H3.
What are the key properties of 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione?
1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione has a molecular weight of 488.63 g/mol, XLogP of 6.62, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dihexoxy-3-(imidazol-1-ylmethyl)anthracene-9,10-dione is sourced from PubChem (CID 24864983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).