C17H26O2 — CID 24865149
(E,3S,8R)-9-[(2S,3S)-3-ethenyloxiran-2-yl]-3,4,8-trimethyl-6-methylidenenon-4-enal (PubChem CID 24865149) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (E,3S,8R)-9-[(2S,3S)-3-ethenyloxiran-2-yl]-3,4,8-trimethyl-6-methylidenenon-4-enal.
| Compound Name | (E,3S,8R)-9-[(2S,3S)-3-ethenyloxiran-2-yl]-3,4,8-trimethyl-6-methylidenenon-4-enal |
|---|---|
| PubChem CID | 24865149 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (E,3S,8R)-9-[(2S,3S)-3-ethenyloxiran-2-yl]-3,4,8-trimethyl-6-methylidenenon-4-enal |
| SMILES | C=C[C@@H]1O[C@H]1C[C@H](C)CC(=C)/C=C(\C)[C@@H](C)CC=O |
| InChI | InChI=1S/C17H26O2/c1-6-16-17(19-16)11-13(3)9-12(2)10-15(5)14(4)7-8-18/h6,8,10,13-14,16-17H,1-2,7,9,11H2,3-5H3/b15-10+/t13-,14+,16+,17+/m1/s1 |
| InChIKey | LONMJUDAQYCSFR-JPZCEIGESA-N |
| XLogP | 4.08 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|