About 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine
2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine (PubChem CID 24865246) has the molecular formula C17H20N4S
and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine |
| PubChem CID | 24865246 |
| Molecular Formula | C17H20N4S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine |
| SMILES | CCc1nn2c(C3CCCNC3)ccnc2c1-c1cccs1 |
| InChI | InChI=1S/C17H20N4S/c1-2-13-16(15-6-4-10-22-15)17-19-9-7-14(21(17)20-13)12-5-3-8-18-11-12/h4,6-7,9-10,12,18H,2-3,5,8,11H2,1H3 |
| InChIKey | WHSCXDGFYZAHTK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine?
The IUPAC name of 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine (CID 24865246) is 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine is CCc1nn2c(C3CCCNC3)ccnc2c1-c1cccs1.
What is the InChIKey of 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine?
The InChIKey is WHSCXDGFYZAHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4S/c1-2-13-16(15-6-4-10-22-15)17-19-9-7-14(21(17)20-13)12-5-3-8-18-11-12/h4,6-7,9-10,12,18H,2-3,5,8,11H2,1H3.
What are the key properties of 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine?
2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine has a molecular weight of 312.44 g/mol, XLogP of 3.49, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-7-piperidin-3-yl-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 24865246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).