C29H44O7Si — CID 24865505
(3R,4S,5R,7S)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-3,4-bis(methoxymethoxy)-5-methyloctan-2-one (PubChem CID 24865505) has the molecular formula C29H44O7Si and a molecular weight of 532.75 g/mol. Its IUPAC name is (3R,4S,5R,7S)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-3,4-bis(methoxymethoxy)-5-methyloctan-2-one.
| Compound Name | (3R,4S,5R,7S)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-3,4-bis(methoxymethoxy)-5-methyloctan-2-one |
|---|---|
| PubChem CID | 24865505 |
| Molecular Formula | C29H44O7Si |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | (3R,4S,5R,7S)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-3,4-bis(methoxymethoxy)-5-methyloctan-2-one |
| SMILES | COCO[C@@H]([C@H](C)C[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](OCOC)C(C)=O |
| InChI | InChI=1S/C29H44O7Si/c1-22(27(34-20-32-6)28(23(2)30)35-21-33-7)18-24(31)19-36-37(29(3,4)5,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-17,22,24,27-28,31H,18-21H2,1-7H3/t22-,24+,27+,28+/m1/s1 |
| InChIKey | IGHUQAGHAKWDDU-OEZPAIJMSA-N |
| XLogP | 3.52 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|