C44H42N2O — CID 24865874
9-prop-2-enyl-1-(1-prop-2-enylindol-3-yl)-2,3-bis(2,4,6-trimethylphenyl)carbazol-4-ol (PubChem CID 24865874) has the molecular formula C44H42N2O and a molecular weight of 614.83 g/mol. Its IUPAC name is 9-prop-2-enyl-1-(1-prop-2-enylindol-3-yl)-2,3-bis(2,4,6-trimethylphenyl)carbazol-4-ol.
| Compound Name | 9-prop-2-enyl-1-(1-prop-2-enylindol-3-yl)-2,3-bis(2,4,6-trimethylphenyl)carbazol-4-ol |
|---|---|
| PubChem CID | 24865874 |
| Molecular Formula | C44H42N2O |
| Molecular Weight | 614.83 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | 9-prop-2-enyl-1-(1-prop-2-enylindol-3-yl)-2,3-bis(2,4,6-trimethylphenyl)carbazol-4-ol |
| SMILES | C=CCn1cc(-c2c(-c3c(C)cc(C)cc3C)c(-c3c(C)cc(C)cc3C)c(O)c3c4ccccc4n(CC=C)c23)c2ccccc21 |
| InChI | InChI=1S/C44H42N2O/c1-9-19-45-25-34(32-15-11-13-17-35(32)45)39-41(37-28(5)21-26(3)22-29(37)6)42(38-30(7)23-27(4)24-31(38)8)44(47)40-33-16-12-14-18-36(33)46(20-10-2)43(39)40/h9-18,21-25,47H,1-2,19-20H2,3-8H3 |
| InChIKey | WQWLDADHPLFCAV-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 30.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.83 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|