C24H26N4O6 — CID 24866388
N,3-bis(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 24866388) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is N,3-bis(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N,3-bis(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 24866388 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N,3-bis(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | COc1cc(Nc2ccn3ncc(-c4cc(OC)c(OC)c(OC)c4)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C24H26N4O6/c1-29-17-9-14(10-18(30-2)22(17)33-5)16-13-25-28-8-7-21(27-24(16)28)26-15-11-19(31-3)23(34-6)20(12-15)32-4/h7-13H,1-6H3,(H,26,27) |
| InChIKey | QSWXIBZQQCBUAM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |