C24H36O5Si — CID 24866418
methyl (8S,9S,10R,11S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-11-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 24866418) has the molecular formula C24H36O5Si and a molecular weight of 432.63 g/mol. Its IUPAC name is methyl (8S,9S,10R,11S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-11-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl (8S,9S,10R,11S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-11-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 24866418 |
| Molecular Formula | C24H36O5Si |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | methyl (8S,9S,10R,11S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-11-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | COC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C |
| InChI | InChI=1S/C24H36O5Si/c1-22-11-9-16(25)13-15(22)7-8-17-18-10-12-24(27,21(26)28-3)23(18,2)14-19(20(17)22)29-30(4,5)6/h9,11,13,17-20,27H,7-8,10,12,14H2,1-6H3/t17-,18-,19-,20+,22-,23-,24-/m0/s1 |
| InChIKey | YRYIOZUPQJGMIL-LNJFAXJLSA-N |
| XLogP | 4.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|