C22H34N2O — CID 24866605
(1S,4S,5R,9R,13R)-N-(2-aminoethyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-10-ene-5-carboxamide (PubChem CID 24866605) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is (1S,4S,5R,9R,13R)-N-(2-aminoethyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-10-ene-5-carboxamide.
| Compound Name | (1S,4S,5R,9R,13R)-N-(2-aminoethyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-10-ene-5-carboxamide |
|---|---|
| PubChem CID | 24866605 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | (1S,4S,5R,9R,13R)-N-(2-aminoethyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-10-ene-5-carboxamide |
| SMILES | C=C1C[C@@]23CC[C@@H]4[C@](C)(C(=O)NCCN)CCC[C@@]4(C)C2=CC[C@@H]1C3 |
| InChI | InChI=1S/C22H34N2O/c1-15-13-22-10-7-17-20(2,18(22)6-5-16(15)14-22)8-4-9-21(17,3)19(25)24-12-11-23/h6,16-17H,1,4-5,7-14,23H2,2-3H3,(H,24,25)/t16-,17+,20-,21-,22-/m1/s1 |
| InChIKey | MZYGFIQGKSACEB-MPMRWZLSSA-N |
| XLogP | 3.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|