C11H11Cl2N — CID 24867041
(1R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 24867041) has the molecular formula C11H11Cl2N and a molecular weight of 228.12 g/mol. Its IUPAC name is (1R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 24867041 |
| Molecular Formula | C11H11Cl2N |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | (1R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | Clc1ccc([C@]23CNCC2C3)cc1Cl |
| InChI | InChI=1S/C11H11Cl2N/c12-9-2-1-7(3-10(9)13)11-4-8(11)5-14-6-11/h1-3,8,14H,4-6H2/t8?,11-/m0/s1 |
| InChIKey | BSMNRYCSBFHEMQ-LYNSQETBSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |