C19H19N3OS — CID 24867057
(4S,5R)-2-amino-1,5-dimethyl-4-[4-(3-prop-1-ynylphenyl)thiophen-2-yl]-4,5-dihydropyrimidin-6-one (PubChem CID 24867057) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is (4S,5R)-2-amino-1,5-dimethyl-4-[4-(3-prop-1-ynylphenyl)thiophen-2-yl]-4,5-dihydropyrimidin-6-one.
| Compound Name | (4S,5R)-2-amino-1,5-dimethyl-4-[4-(3-prop-1-ynylphenyl)thiophen-2-yl]-4,5-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 24867057 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (4S,5R)-2-amino-1,5-dimethyl-4-[4-(3-prop-1-ynylphenyl)thiophen-2-yl]-4,5-dihydropyrimidin-6-one |
| SMILES | CC#Cc1cccc(-c2csc([C@H]3N=C(N)N(C)C(=O)[C@@H]3C)c2)c1 |
| InChI | InChI=1S/C19H19N3OS/c1-4-6-13-7-5-8-14(9-13)15-10-16(24-11-15)17-12(2)18(23)22(3)19(20)21-17/h5,7-12,17H,1-3H3,(H2,20,21)/t12-,17+/m1/s1 |
| InChIKey | UZCSJURQNGFWTF-PXAZEXFGSA-N |
| XLogP | 3.25 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|