C15H18O3 — CID 24867644
2-[(5R,6S)-6-ethenyl-3,6-dimethyl-5,7-dihydro-4H-1-benzofuran-5-yl]prop-2-enoic acid (PubChem CID 24867644) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[(5R,6S)-6-ethenyl-3,6-dimethyl-5,7-dihydro-4H-1-benzofuran-5-yl]prop-2-enoic acid.
| Compound Name | 2-[(5R,6S)-6-ethenyl-3,6-dimethyl-5,7-dihydro-4H-1-benzofuran-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 24867644 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-[(5R,6S)-6-ethenyl-3,6-dimethyl-5,7-dihydro-4H-1-benzofuran-5-yl]prop-2-enoic acid |
| SMILES | C=C[C@]1(C)Cc2occ(C)c2C[C@H]1C(=C)C(=O)O |
| InChI | InChI=1S/C15H18O3/c1-5-15(4)7-13-11(9(2)8-18-13)6-12(15)10(3)14(16)17/h5,8,12H,1,3,6-7H2,2,4H3,(H,16,17)/t12-,15+/m0/s1 |
| InChIKey | VZTBSJNBYKYYRW-SWLSCSKDSA-N |
| XLogP | 3.14 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|