About 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one
6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one (PubChem CID 24867653) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one.
Molecular Properties
| Compound Name | 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one |
| PubChem CID | 24867653 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one |
| SMILES | C/C(Nc1ccc2oc(=O)ccc2c1)=C1/C(=O)CC2[C@@H]1C2(C)C |
| InChI | InChI=1S/C19H19NO3/c1-10(17-14(21)9-13-18(17)19(13,2)3)20-12-5-6-15-11(8-12)4-7-16(22)23-15/h4-8,13,18,20H,9H2,1-3H3/b17-10+/t13?,18-/m0/s1 |
| InChIKey | PNUQCGVJIJFTAX-VKTADIDOSA-N |
| XLogP | 3.72 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one?
The IUPAC name of 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one (CID 24867653) is 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one.
What is the SMILES notation for 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one?
The canonical SMILES for 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one is C/C(Nc1ccc2oc(=O)ccc2c1)=C1/C(=O)CC2[C@@H]1C2(C)C.
What is the InChIKey of 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one?
The InChIKey is PNUQCGVJIJFTAX-VKTADIDOSA-N. The full InChI is InChI=1S/C19H19NO3/c1-10(17-14(21)9-13-18(17)19(13,2)3)20-12-5-6-15-11(8-12)4-7-16(22)23-15/h4-8,13,18,20H,9H2,1-3H3/b17-10+/t13?,18-/m0/s1.
What are the key properties of 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one?
6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one has a molecular weight of 309.37 g/mol, XLogP of 3.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(1Z)-1-[(1R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]amino]chromen-2-one is sourced from PubChem (CID 24867653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).