C27H39NO3 — CID 24867660
(1R,6R,9S,10R,11R,14R,16S,23R,24S)-16-hydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-18-ene-3,20-dione (PubChem CID 24867660) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is (1R,6R,9S,10R,11R,14R,16S,23R,24S)-16-hydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-18-ene-3,20-dione.
| Compound Name | (1R,6R,9S,10R,11R,14R,16S,23R,24S)-16-hydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-18-ene-3,20-dione |
|---|---|
| PubChem CID | 24867660 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | (1R,6R,9S,10R,11R,14R,16S,23R,24S)-16-hydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-18-ene-3,20-dione |
| SMILES | C[C@@H]1CC[C@H]2[C@H](C)[C@H]3CC[C@H]4C5C(O)CC6=CC(=O)CC[C@]6(C)[C@H]5C[C@H]4C3C(=O)N2C1 |
| InChI | InChI=1S/C27H39NO3/c1-14-4-7-22-15(2)18-5-6-19-20(24(18)26(31)28(22)13-14)12-21-25(19)23(30)11-16-10-17(29)8-9-27(16,21)3/h10,14-15,18-25,30H,4-9,11-13H2,1-3H3/t14-,15-,18-,19-,20-,21+,22+,23?,24?,25?,27+/m1/s1 |
| InChIKey | JRKNTCDSHHKHTC-CTUUTQPBSA-N |
| XLogP | 4.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |