C19H19NO8S — CID 24867672
3-(4-methyl-1,3-thiazol-2-yl)-7-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one (PubChem CID 24867672) has the molecular formula C19H19NO8S and a molecular weight of 421.43 g/mol. Its IUPAC name is 3-(4-methyl-1,3-thiazol-2-yl)-7-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one.
| Compound Name | 3-(4-methyl-1,3-thiazol-2-yl)-7-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 24867672 |
| Molecular Formula | C19H19NO8S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 3-(4-methyl-1,3-thiazol-2-yl)-7-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| SMILES | Cc1csc(-c2coc3cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]4O)ccc3c2=O)n1 |
| InChI | InChI=1S/C19H19NO8S/c1-8-7-29-18(20-8)11-6-26-12-4-9(2-3-10(12)14(11)22)27-19-17(25)16(24)15(23)13(5-21)28-19/h2-4,6-7,13,15-17,19,21,23-25H,5H2,1H3/t13-,15-,16-,17-,19-/m1/s1 |
| InChIKey | KPYJUZGASBQBNI-OAIGWWADSA-N |
| XLogP | 0.40 |
| TPSA | 142.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |