About (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate
(5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate (PubChem CID 24867698) has the molecular formula C19H23ClO5
and a molecular weight of 366.84 g/mol. Its IUPAC name is (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate.
Molecular Properties
| Compound Name | (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate |
| PubChem CID | 24867698 |
| Molecular Formula | C19H23ClO5 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate |
| SMILES | CCCCCCCC1=CC2=C(Cl)C(=O)C(C)(OC(C)=O)C(=O)C2=CO1 |
| InChI | InChI=1S/C19H23ClO5/c1-4-5-6-7-8-9-13-10-14-15(11-24-13)17(22)19(3,25-12(2)21)18(23)16(14)20/h10-11H,4-9H2,1-3H3 |
| InChIKey | XVIIHRBPXVGKRK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate?
The IUPAC name of (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate (CID 24867698) is (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate.
What is the SMILES notation for (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate?
The canonical SMILES for (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate is CCCCCCCC1=CC2=C(Cl)C(=O)C(C)(OC(C)=O)C(=O)C2=CO1.
What is the InChIKey of (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate?
The InChIKey is XVIIHRBPXVGKRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23ClO5/c1-4-5-6-7-8-9-13-10-14-15(11-24-13)17(22)19(3,25-12(2)21)18(23)16(14)20/h10-11H,4-9H2,1-3H3.
What are the key properties of (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate?
(5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate has a molecular weight of 366.84 g/mol, XLogP of 4.11, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) acetate is sourced from PubChem (CID 24867698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).