About propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate
propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate (PubChem CID 24867728) has the molecular formula C15H28O5
and a molecular weight of 288.38 g/mol. Its IUPAC name is propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate |
| PubChem CID | 24867728 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate |
| SMILES | CO[C@@H](CCO)C[C@H]1O[C@H](C(=O)OC(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C15H28O5/c1-10(2)19-15(17)13-6-5-11(3)14(20-13)9-12(18-4)7-8-16/h10-14,16H,5-9H2,1-4H3/t11-,12-,13-,14+/m0/s1 |
| InChIKey | JVPDZPADHFEIKJ-XDQVBPFNSA-N |
| XLogP | 1.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate?
The IUPAC name of propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate (CID 24867728) is propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate.
What is the SMILES notation for propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate?
The canonical SMILES for propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate is CO[C@@H](CCO)C[C@H]1O[C@H](C(=O)OC(C)C)CC[C@@H]1C.
What is the InChIKey of propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate?
The InChIKey is JVPDZPADHFEIKJ-XDQVBPFNSA-N. The full InChI is InChI=1S/C15H28O5/c1-10(2)19-15(17)13-6-5-11(3)14(20-13)9-12(18-4)7-8-16/h10-14,16H,5-9H2,1-4H3/t11-,12-,13-,14+/m0/s1.
What are the key properties of propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate?
propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate has a molecular weight of 288.38 g/mol, XLogP of 1.91, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2S,5S,6R)-6-[(2S)-4-hydroxy-2-methoxybutyl]-5-methyloxane-2-carboxylate is sourced from PubChem (CID 24867728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).