C16H25BrO5Si — CID 24867759
[(1R,2R,6R)-4-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate (PubChem CID 24867759) has the molecular formula C16H25BrO5Si and a molecular weight of 405.36 g/mol. Its IUPAC name is [(1R,2R,6R)-4-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate.
| Compound Name | [(1R,2R,6R)-4-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 24867759 |
| Molecular Formula | C16H25BrO5Si |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | [(1R,2R,6R)-4-bromo-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(CO[Si](C)(C)C(C)(C)C)=C(Br)C(=O)[C@@H]2O[C@]12C |
| InChI | InChI=1S/C16H25BrO5Si/c1-9(18)21-13-10(8-20-23(6,7)15(2,3)4)11(17)12(19)14-16(13,5)22-14/h13-14H,8H2,1-7H3/t13-,14+,16-/m1/s1 |
| InChIKey | SKMOFBACQDORIZ-IJEWVQPXSA-N |
| XLogP | 3.33 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|