About 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one
2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one (PubChem CID 24867797) has the molecular formula C16H28O2Si
and a molecular weight of 280.48 g/mol. Its IUPAC name is 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one |
| PubChem CID | 24867797 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one |
| SMILES | C/C(=C\C[Si](C)(C)C)CC[C@H](O)C1=CCCCC1=O |
| InChI | InChI=1S/C16H28O2Si/c1-13(11-12-19(2,3)4)9-10-16(18)14-7-5-6-8-15(14)17/h7,11,16,18H,5-6,8-10,12H2,1-4H3/b13-11+/t16-/m0/s1 |
| InChIKey | OCMYGRLIIUMCLJ-BYIUCRAPSA-N |
| XLogP | 4.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one?
The IUPAC name of 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one (CID 24867797) is 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one.
What is the SMILES notation for 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one?
The canonical SMILES for 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one is C/C(=C\C[Si](C)(C)C)CC[C@H](O)C1=CCCCC1=O.
What is the InChIKey of 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one?
The InChIKey is OCMYGRLIIUMCLJ-BYIUCRAPSA-N. The full InChI is InChI=1S/C16H28O2Si/c1-13(11-12-19(2,3)4)9-10-16(18)14-7-5-6-8-15(14)17/h7,11,16,18H,5-6,8-10,12H2,1-4H3/b13-11+/t16-/m0/s1.
What are the key properties of 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one?
2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one has a molecular weight of 280.48 g/mol, XLogP of 4.09, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E,1S)-1-hydroxy-4-methyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one is sourced from PubChem (CID 24867797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).