C11H15N5O9P2-2 — CID 24867852
[(2R,3S,5R)-3-[hydroxy(oxido)phosphoryl]oxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 24867852) has the molecular formula C11H15N5O9P2-2 and a molecular weight of 423.22 g/mol. Its IUPAC name is [(2R,3S,5R)-3-[hydroxy(oxido)phosphoryl]oxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-3-[hydroxy(oxido)phosphoryl]oxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 24867852 |
| Molecular Formula | C11H15N5O9P2-2 |
| Molecular Weight | 423.22 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | [(2R,3S,5R)-3-[hydroxy(oxido)phosphoryl]oxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CNc1ncnc2c1ncn2[C@H]1C[C@H](OP(=O)([O-])O)[C@@H](COP(=O)([O-])O)O1 |
| InChI | InChI=1S/C11H17N5O9P2/c1-12-10-9-11(14-4-13-10)16(5-15-9)8-2-6(25-27(20,21)22)7(24-8)3-23-26(17,18)19/h4-8H,2-3H2,1H3,(H,12,13,14)(H2,17,18,19)(H2,20,21,22)/p-2/t6-,7+,8+/m0/s1 |
| InChIKey | CCPLITQNIFLYQB-XLPZGREQSA-L |
| XLogP | -1.52 |
| TPSA | 204.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.22 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|