C31H39NO2 — CID 24867898
2-benzyl-3-[2-methoxy-5-[(E)-oct-1-enyl]phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 24867898) has the molecular formula C31H39NO2 and a molecular weight of 457.66 g/mol. Its IUPAC name is 2-benzyl-3-[2-methoxy-5-[(E)-oct-1-enyl]phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | 2-benzyl-3-[2-methoxy-5-[(E)-oct-1-enyl]phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 24867898 |
| Molecular Formula | C31H39NO2 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | 2-benzyl-3-[2-methoxy-5-[(E)-oct-1-enyl]phenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | CCCCCC/C=C/c1ccc(OC)c(C2C3C=CCC(C)C3C(=O)N2Cc2ccccc2)c1 |
| InChI | InChI=1S/C31H39NO2/c1-4-5-6-7-8-10-15-24-19-20-28(34-3)27(21-24)30-26-18-13-14-23(2)29(26)31(33)32(30)22-25-16-11-9-12-17-25/h9-13,15-21,23,26,29-30H,4-8,14,22H2,1-3H3/b15-10+ |
| InChIKey | FZMDQOANFAKWNL-XNTDXEJSSA-N |
| XLogP | 7.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|