C30H31FN2O — CID 24868072
2-benzyl-3-[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 24868072) has the molecular formula C30H31FN2O and a molecular weight of 454.59 g/mol. Its IUPAC name is 2-benzyl-3-[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | 2-benzyl-3-[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 24868072 |
| Molecular Formula | C30H31FN2O |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 2-benzyl-3-[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]-7-methyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | CC1CC=CC2C1C(=O)N(Cc1ccccc1)C2c1ccc(-c2ccc(N(C)C)cc2)cc1F |
| InChI | InChI=1S/C30H31FN2O/c1-20-8-7-11-26-28(20)30(34)33(19-21-9-5-4-6-10-21)29(26)25-17-14-23(18-27(25)31)22-12-15-24(16-13-22)32(2)3/h4-7,9-18,20,26,28-29H,8,19H2,1-3H3 |
| InChIKey | OGOYFYBJGOZDCJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|