About 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one
4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one (PubChem CID 24868075) has the molecular formula C28H32N2OS
and a molecular weight of 444.64 g/mol. Its IUPAC name is 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one |
| PubChem CID | 24868075 |
| Molecular Formula | C28H32N2OS |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one |
| SMILES | Cc1ccc(SCC(c2ccccc2)N2CCN(CCc3ccccc3)CCC2=O)cc1 |
| InChI | InChI=1S/C28H32N2OS/c1-23-12-14-26(15-13-23)32-22-27(25-10-6-3-7-11-25)30-21-20-29(19-17-28(30)31)18-16-24-8-4-2-5-9-24/h2-15,27H,16-22H2,1H3 |
| InChIKey | FTZOLYIYBDDYHP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one?
The IUPAC name of 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one (CID 24868075) is 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one.
What is the SMILES notation for 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one?
The canonical SMILES for 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one is Cc1ccc(SCC(c2ccccc2)N2CCN(CCc3ccccc3)CCC2=O)cc1.
What is the InChIKey of 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one?
The InChIKey is FTZOLYIYBDDYHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H32N2OS/c1-23-12-14-26(15-13-23)32-22-27(25-10-6-3-7-11-25)30-21-20-29(19-17-28(30)31)18-16-24-8-4-2-5-9-24/h2-15,27H,16-22H2,1H3.
What are the key properties of 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one?
4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one has a molecular weight of 444.64 g/mol, XLogP of 5.61, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-methylphenyl)sulfanyl-1-phenylethyl]-1-(2-phenylethyl)-1,4-diazepan-5-one is sourced from PubChem (CID 24868075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).