About 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide
3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide (PubChem CID 24868076) has the molecular formula C14H17NO3S
and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide.
Molecular Properties
| Compound Name | 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide |
| PubChem CID | 24868076 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide |
| SMILES | O=S1(=O)C2CC3CCC2(CN1Cc1ccccc1)O3 |
| InChI | InChI=1S/C14H17NO3S/c16-19(17)13-8-12-6-7-14(13,18-12)10-15(19)9-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2 |
| InChIKey | QYQIEZCUEMFBII-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide?
The IUPAC name of 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide (CID 24868076) is 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide.
What is the SMILES notation for 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide?
The canonical SMILES for 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide is O=S1(=O)C2CC3CCC2(CN1Cc1ccccc1)O3.
What is the InChIKey of 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide?
The InChIKey is QYQIEZCUEMFBII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3S/c16-19(17)13-8-12-6-7-14(13,18-12)10-15(19)9-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2.
What are the key properties of 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide?
3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide has a molecular weight of 279.36 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-10-oxa-4λ6-thia-3-azatricyclo[5.2.1.01,5]decane 4,4-dioxide is sourced from PubChem (CID 24868076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).