C22H26O8 — CID 24868495
[3-hydroxy-1-[(9-methoxy-7-oxo-5,6-dihydrofuro[3,2-g]chromen-4-yl)oxy]-3-methylbutan-2-yl] (Z)-2-methylbut-2-enoate (PubChem CID 24868495) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is [3-hydroxy-1-[(9-methoxy-7-oxo-5,6-dihydrofuro[3,2-g]chromen-4-yl)oxy]-3-methylbutan-2-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [3-hydroxy-1-[(9-methoxy-7-oxo-5,6-dihydrofuro[3,2-g]chromen-4-yl)oxy]-3-methylbutan-2-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 24868495 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [3-hydroxy-1-[(9-methoxy-7-oxo-5,6-dihydrofuro[3,2-g]chromen-4-yl)oxy]-3-methylbutan-2-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC(COc1c2c(c(OC)c3occc13)OC(=O)CC2)C(C)(C)O |
| InChI | InChI=1S/C22H26O8/c1-6-12(2)21(24)29-15(22(3,4)25)11-28-17-13-7-8-16(23)30-19(13)20(26-5)18-14(17)9-10-27-18/h6,9-10,15,25H,7-8,11H2,1-5H3/b12-6- |
| InChIKey | JKZHBNAUNVEBGE-SDQBBNPISA-N |
| XLogP | 3.32 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|