C20H29NO4 — CID 24869400
16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-15(20),16-diene (PubChem CID 24869400) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-15(20),16-diene.
| Compound Name | 16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-15(20),16-diene |
|---|---|
| PubChem CID | 24869400 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-15(20),16-diene |
| SMILES | COC1=C(OC)C2=C(CC1)CC1C3CC4OCOC4CC3CCN1C2 |
| InChI | InChI=1S/C20H29NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h13-14,16,18-19H,3-11H2,1-2H3 |
| InChIKey | RGAUNSXGSUQSRV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |