C12H22NO3P — CID 24869425
N,N-diethyl-3-oxo-2,4,6,7,8,9-hexahydro-1,5,3λ5-benzodioxaphosphepin-3-amine (PubChem CID 24869425) has the molecular formula C12H22NO3P and a molecular weight of 259.29 g/mol. Its IUPAC name is N,N-diethyl-3-oxo-2,4,6,7,8,9-hexahydro-1,5,3λ5-benzodioxaphosphepin-3-amine.
| Compound Name | N,N-diethyl-3-oxo-2,4,6,7,8,9-hexahydro-1,5,3λ5-benzodioxaphosphepin-3-amine |
|---|---|
| PubChem CID | 24869425 |
| Molecular Formula | C12H22NO3P |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N,N-diethyl-3-oxo-2,4,6,7,8,9-hexahydro-1,5,3λ5-benzodioxaphosphepin-3-amine |
| SMILES | CCN(CC)P1(=O)COC2=C(CCCC2)OC1 |
| InChI | InChI=1S/C12H22NO3P/c1-3-13(4-2)17(14)9-15-11-7-5-6-8-12(11)16-10-17/h3-10H2,1-2H3 |
| InChIKey | IXIBGTNGJACSJW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|