C13H23NO — CID 24869430
2-(1-methyl-3,4,5,6,7,8-hexahydro-2H-isoquinolin-1-yl)propan-2-ol (PubChem CID 24869430) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2-(1-methyl-3,4,5,6,7,8-hexahydro-2H-isoquinolin-1-yl)propan-2-ol.
| Compound Name | 2-(1-methyl-3,4,5,6,7,8-hexahydro-2H-isoquinolin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 24869430 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2-(1-methyl-3,4,5,6,7,8-hexahydro-2H-isoquinolin-1-yl)propan-2-ol |
| SMILES | CC(C)(O)C1(C)NCCC2=C1CCCC2 |
| InChI | InChI=1S/C13H23NO/c1-12(2,15)13(3)11-7-5-4-6-10(11)8-9-14-13/h14-15H,4-9H2,1-3H3 |
| InChIKey | FJKDXCUCVZMWBV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|