About [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium
[1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium (PubChem CID 24869455) has the molecular formula C12H14FN2O3S+
and a molecular weight of 285.32 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium.
Molecular Properties
| Compound Name | [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium |
| PubChem CID | 24869455 |
| Molecular Formula | C12H14FN2O3S+ |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium |
| SMILES | C[S+](C)C1C(=O)NC(=O)N(c2ccccc2F)C1O |
| InChI | InChI=1S/C12H13FN2O3S/c1-19(2)9-10(16)14-12(18)15(11(9)17)8-6-4-3-5-7(8)13/h3-6,9,11,17H,1-2H3/p+1 |
| InChIKey | FZASVJDFPUPSCH-UHFFFAOYSA-O |
| XLogP | 0.45 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium?
The IUPAC name of [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium (CID 24869455) is [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium.
What is the SMILES notation for [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium?
The canonical SMILES for [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium is C[S+](C)C1C(=O)NC(=O)N(c2ccccc2F)C1O.
What is the InChIKey of [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium?
The InChIKey is FZASVJDFPUPSCH-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H13FN2O3S/c1-19(2)9-10(16)14-12(18)15(11(9)17)8-6-4-3-5-7(8)13/h3-6,9,11,17H,1-2H3/p+1.
What are the key properties of [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium?
[1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium has a molecular weight of 285.32 g/mol, XLogP of 0.45, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-fluorophenyl)-6-hydroxy-2,4-dioxo-1,3-diazinan-5-yl]-dimethylsulfanium is sourced from PubChem (CID 24869455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).