About 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane
12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane (PubChem CID 24869481) has the molecular formula C20H29NS
and a molecular weight of 315.53 g/mol. Its IUPAC name is 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane.
Molecular Properties
| Compound Name | 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane |
| PubChem CID | 24869481 |
| Molecular Formula | C20H29NS |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane |
| SMILES | c1csc(C2NC3CCC4CCCCC4C3C3CCCC23)c1 |
| InChI | InChI=1S/C20H29NS/c1-2-6-14-13(5-1)10-11-17-19(14)15-7-3-8-16(15)20(21-17)18-9-4-12-22-18/h4,9,12-17,19-21H,1-3,5-8,10-11H2 |
| InChIKey | PSEWDVNIYACYOC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane?
The IUPAC name of 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane (CID 24869481) is 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane.
What is the SMILES notation for 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane?
The canonical SMILES for 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane is c1csc(C2NC3CCC4CCCCC4C3C3CCCC23)c1.
What is the InChIKey of 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane?
The InChIKey is PSEWDVNIYACYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NS/c1-2-6-14-13(5-1)10-11-17-19(14)15-7-3-8-16(15)20(21-17)18-9-4-12-22-18/h4,9,12-17,19-21H,1-3,5-8,10-11H2.
What are the key properties of 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane?
12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane has a molecular weight of 315.53 g/mol, XLogP of 5.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-thiophen-2-yl-11-azatetracyclo[8.7.0.02,7.013,17]heptadecane is sourced from PubChem (CID 24869481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).