C14H25N3OS — CID 24869862
6-(2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-amine (PubChem CID 24869862) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is 6-(2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-amine.
| Compound Name | 6-(2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 24869862 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 6-(2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-amine |
| SMILES | NC1NC2CCC(C3NC4CCCCC4O3)CC2S1 |
| InChI | InChI=1S/C14H25N3OS/c15-14-17-10-6-5-8(7-12(10)19-14)13-16-9-3-1-2-4-11(9)18-13/h8-14,16-17H,1-7,15H2 |
| InChIKey | XDVIOGOLRMQSOX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |