C14H21N2+ — CID 24869867
3-(2,3,3-trimethyl-4,5,6,7-tetrahydroindol-1-ium-1-yl)propanenitrile (PubChem CID 24869867) has the molecular formula C14H21N2+ and a molecular weight of 217.34 g/mol. Its IUPAC name is 3-(2,3,3-trimethyl-4,5,6,7-tetrahydroindol-1-ium-1-yl)propanenitrile.
| Compound Name | 3-(2,3,3-trimethyl-4,5,6,7-tetrahydroindol-1-ium-1-yl)propanenitrile |
|---|---|
| PubChem CID | 24869867 |
| Molecular Formula | C14H21N2+ |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 3-(2,3,3-trimethyl-4,5,6,7-tetrahydroindol-1-ium-1-yl)propanenitrile |
| SMILES | CC1=[N+](CCC#N)C2=C(CCCC2)C1(C)C |
| InChI | InChI=1S/C14H21N2/c1-11-14(2,3)12-7-4-5-8-13(12)16(11)10-6-9-15/h4-8,10H2,1-3H3/q+1 |
| InChIKey | BKOWBNWMZZLCEB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|